C17H16BrN3O2 — CID 67085882
6-bromo-N-[(2,4-dimethoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 67085882) has the molecular formula C17H16BrN3O2 and a molecular weight of 374.24 g/mol. Its IUPAC name is 6-bromo-N-[(2,4-dimethoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[(2,4-dimethoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 67085882 |
| Molecular Formula | C17H16BrN3O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 6-bromo-N-[(2,4-dimethoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3ccc(Br)cc23)c(OC)c1 |
| InChI | InChI=1S/C17H16BrN3O2/c1-22-13-5-3-11(16(8-13)23-2)9-19-17-14-7-12(18)4-6-15(14)20-10-21-17/h3-8,10H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | PRRDXULBKQOEQK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |