C18H17N3O4 — CID 67042839
4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxylic acid (PubChem CID 67042839) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxylic acid.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 67042839 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxylic acid |
| SMILES | COc1ccc(CNc2ncnc3c(C(=O)O)cccc23)c(OC)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-24-12-7-6-11(15(8-12)25-2)9-19-17-13-4-3-5-14(18(22)23)16(13)20-10-21-17/h3-8,10H,9H2,1-2H3,(H,22,23)(H,19,20,21) |
| InChIKey | VHEKPONCTOPSAX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |