C28H24ClN5O3 — CID 163272171
N-(1-chloro-6-methylisoquinolin-5-yl)-4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxamide (PubChem CID 163272171) has the molecular formula C28H24ClN5O3 and a molecular weight of 513.99 g/mol. Its IUPAC name is N-(1-chloro-6-methylisoquinolin-5-yl)-4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxamide.
| Compound Name | N-(1-chloro-6-methylisoquinolin-5-yl)-4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 163272171 |
| Molecular Formula | C28H24ClN5O3 |
| Molecular Weight | 513.99 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-(1-chloro-6-methylisoquinolin-5-yl)-4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxamide |
| SMILES | COc1ccc(CNc2ncnc3c(C(=O)Nc4c(C)ccc5c(Cl)nccc45)cccc23)c(OC)c1 |
| InChI | InChI=1S/C28H24ClN5O3/c1-16-7-10-20-19(11-12-30-26(20)29)24(16)34-28(35)22-6-4-5-21-25(22)32-15-33-27(21)31-14-17-8-9-18(36-2)13-23(17)37-3/h4-13,15H,14H2,1-3H3,(H,34,35)(H,31,32,33) |
| InChIKey | IVRNDJXPLAFCOK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.99 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|