C20H21N3O4 — CID 174593383
2-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-8-yl]ethyl formate (PubChem CID 174593383) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-8-yl]ethyl formate.
| Compound Name | 2-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-8-yl]ethyl formate |
|---|---|
| PubChem CID | 174593383 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-8-yl]ethyl formate |
| SMILES | COc1ccc(CNc2ncnc3c(CCOC=O)cccc23)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-25-16-7-6-15(18(10-16)26-2)11-21-20-17-5-3-4-14(8-9-27-13-24)19(17)22-12-23-20/h3-7,10,12-13H,8-9,11H2,1-2H3,(H,21,22,23) |
| InChIKey | PSONGCVMUHVJKE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|