C28H29N5O4 — CID 140638634
4-[[3-[[4-[3-(dimethylamino)propoxy]benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxylic acid (PubChem CID 140638634) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is 4-[[3-[[4-[3-(dimethylamino)propoxy]benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxylic acid.
| Compound Name | 4-[[3-[[4-[3-(dimethylamino)propoxy]benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 140638634 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 4-[[3-[[4-[3-(dimethylamino)propoxy]benzoyl]amino]phenyl]methylamino]quinazoline-8-carboxylic acid |
| SMILES | CN(C)CCCOc1ccc(C(=O)Nc2cccc(CNc3ncnc4c(C(=O)O)cccc34)c2)cc1 |
| InChI | InChI=1S/C28H29N5O4/c1-33(2)14-5-15-37-22-12-10-20(11-13-22)27(34)32-21-7-3-6-19(16-21)17-29-26-23-8-4-9-24(28(35)36)25(23)30-18-31-26/h3-4,6-13,16,18H,5,14-15,17H2,1-2H3,(H,32,34)(H,35,36)(H,29,30,31) |
| InChIKey | KENVDDZVOKMHDQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|