C27H26N6O3 — CID 66763033
4-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide (PubChem CID 66763033) has the molecular formula C27H26N6O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is 4-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide.
| Compound Name | 4-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 66763033 |
| Molecular Formula | C27H26N6O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 4-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxamide |
| SMILES | NC(=O)c1cccc2c(NCc3cccc(NC(=O)c4ccc(N5CCOCC5)cc4)c3)ncnc12 |
| InChI | InChI=1S/C27H26N6O3/c28-25(34)22-5-2-6-23-24(22)30-17-31-26(23)29-16-18-3-1-4-20(15-18)32-27(35)19-7-9-21(10-8-19)33-11-13-36-14-12-33/h1-10,15,17H,11-14,16H2,(H2,28,34)(H,32,35)(H,29,30,31) |
| InChIKey | QGTVJLQYTUPQRC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |