C27H25N5O4 — CID 140638692
4-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxylic acid (PubChem CID 140638692) has the molecular formula C27H25N5O4 and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxylic acid.
| Compound Name | 4-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 140638692 |
| Molecular Formula | C27H25N5O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 4-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methylamino]quinazoline-8-carboxylic acid |
| SMILES | O=C(Nc1cccc(CNc2ncnc3c(C(=O)O)cccc23)c1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H25N5O4/c33-26(19-7-9-21(10-8-19)32-11-13-36-14-12-32)31-20-4-1-3-18(15-20)16-28-25-22-5-2-6-23(27(34)35)24(22)29-17-30-25/h1-10,15,17H,11-14,16H2,(H,31,33)(H,34,35)(H,28,29,30) |
| InChIKey | LFLMHINGALWBGN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |