C28H29N5O3 — CID 174753942
4-methoxy-N-[3-[[[6-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]methyl]phenyl]benzamide (PubChem CID 174753942) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-methoxy-N-[3-[[[6-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]methyl]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[[[6-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 174753942 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-methoxy-N-[3-[[[6-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]methyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(CNc3ncnc4ccc(CN5CCOCC5)cc34)c2)cc1 |
| InChI | InChI=1S/C28H29N5O3/c1-35-24-8-6-22(7-9-24)28(34)32-23-4-2-3-20(15-23)17-29-27-25-16-21(5-10-26(25)30-19-31-27)18-33-11-13-36-14-12-33/h2-10,15-16,19H,11-14,17-18H2,1H3,(H,32,34)(H,29,30,31) |
| InChIKey | PJRHWEKPKPBPCA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |