C30H33N5O5 — CID 66550689
3-methoxy-N-[4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]benzamide (PubChem CID 66550689) has the molecular formula C30H33N5O5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 3-methoxy-N-[4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]benzamide.
| Compound Name | 3-methoxy-N-[4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 66550689 |
| Molecular Formula | C30H33N5O5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 3-methoxy-N-[4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(Nc3ncnc4cc(OCCCN5CCOCC5)c(OC)cc34)cc2)c1 |
| InChI | InChI=1S/C30H33N5O5/c1-37-24-6-3-5-21(17-24)30(36)34-23-9-7-22(8-10-23)33-29-25-18-27(38-2)28(19-26(25)31-20-32-29)40-14-4-11-35-12-15-39-16-13-35/h3,5-10,17-20H,4,11-16H2,1-2H3,(H,34,36)(H,31,32,33) |
| InChIKey | LKSVROHEECFGAX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|