C29H32N6O4 — CID 71471023
N-(2-aminophenyl)-4-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]benzamide (PubChem CID 71471023) has the molecular formula C29H32N6O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 71471023 |
| Molecular Formula | C29H32N6O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-(2-aminophenyl)-4-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]benzamide |
| SMILES | COc1cc2ncnc(Nc3ccc(C(=O)Nc4ccccc4N)cc3)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C29H32N6O4/c1-37-26-18-25-22(17-27(26)39-14-4-11-35-12-15-38-16-13-35)28(32-19-31-25)33-21-9-7-20(8-10-21)29(36)34-24-6-3-2-5-23(24)30/h2-3,5-10,17-19H,4,11-16,30H2,1H3,(H,34,36)(H,31,32,33) |
| InChIKey | WDOGCXAEDCAQGJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|