C29H29N5O4 — CID 175809881
2-[4-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenoxy]benzonitrile (PubChem CID 175809881) has the molecular formula C29H29N5O4 and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-[4-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenoxy]benzonitrile.
| Compound Name | 2-[4-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 175809881 |
| Molecular Formula | C29H29N5O4 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-[4-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenoxy]benzonitrile |
| SMILES | COc1cc2ncnc(Nc3ccc(Oc4ccccc4C#N)cc3)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C29H29N5O4/c1-35-27-18-25-24(17-28(27)37-14-4-11-34-12-15-36-16-13-34)29(32-20-31-25)33-22-7-9-23(10-8-22)38-26-6-3-2-5-21(26)19-30/h2-3,5-10,17-18,20H,4,11-16H2,1H3,(H,31,32,33) |
| InChIKey | HCSYUVYVLNBFMW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|