C32H36N4O5 — CID 141309114
N-[4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine (PubChem CID 141309114) has the molecular formula C32H36N4O5 and a molecular weight of 556.66 g/mol. Its IUPAC name is N-[4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
| Compound Name | N-[4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 141309114 |
| Molecular Formula | C32H36N4O5 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | N-[4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]phenyl]-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1ccc(/C=C/c2ccc(Nc3ncnc4cc(OC)c(OCCCN5CCOCC5)cc34)cc2)cc1OC |
| InChI | InChI=1S/C32H36N4O5/c1-37-28-12-9-24(19-29(28)38-2)6-5-23-7-10-25(11-8-23)35-32-26-20-31(30(39-3)21-27(26)33-22-34-32)41-16-4-13-36-14-17-40-18-15-36/h5-12,19-22H,4,13-18H2,1-3H3,(H,33,34,35)/b6-5+ |
| InChIKey | DQXFHGKOYMCHIU-AATRIKPKSA-N |
| XLogP | 5.67 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|