C22H27N5O5 — CID 58608335
4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-1-methylpyrrole-2-carboxylic acid (PubChem CID 58608335) has the molecular formula C22H27N5O5 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 58608335 |
| Molecular Formula | C22H27N5O5 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-1-methylpyrrole-2-carboxylic acid |
| SMILES | COc1cc2c(Nc3cc(C(=O)O)n(C)c3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C22H27N5O5/c1-26-13-15(10-18(26)22(28)29)25-21-16-11-19(30-2)20(12-17(16)23-14-24-21)32-7-3-4-27-5-8-31-9-6-27/h10-14H,3-9H2,1-2H3,(H,28,29)(H,23,24,25) |
| InChIKey | VDMNKDSCENUGFS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|