C23H33N5O5S — CID 142104621
ethane;methane;2-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 142104621) has the molecular formula C23H33N5O5S and a molecular weight of 491.61 g/mol. Its IUPAC name is ethane;methane;2-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | ethane;methane;2-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 142104621 |
| Molecular Formula | C23H33N5O5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | ethane;methane;2-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | C.CC.COc1cc2c(Nc3nc(C(=O)O)cs3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C20H23N5O5S.C2H6.CH4/c1-28-16-9-13-14(10-17(16)30-6-2-3-25-4-7-29-8-5-25)21-12-22-18(13)24-20-23-15(11-31-20)19(26)27;1-2;/h9-12H,2-8H2,1H3,(H,26,27)(H,21,22,23,24);1-2H3;1H4 |
| InChIKey | QYXMIBMOCCSLQU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|