C22H27N5O3 — CID 142051918
6-methoxy-N-(5-methyl-2-pyridinyl)-7-(3-morpholin-4-ylpropoxy)quinazolin-4-amine (PubChem CID 142051918) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 6-methoxy-N-(5-methyl-2-pyridinyl)-7-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
| Compound Name | 6-methoxy-N-(5-methyl-2-pyridinyl)-7-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 142051918 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 6-methoxy-N-(5-methyl-2-pyridinyl)-7-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(C)cn3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C22H27N5O3/c1-16-4-5-21(23-14-16)26-22-17-12-19(28-2)20(13-18(17)24-15-25-22)30-9-3-6-27-7-10-29-11-8-27/h4-5,12-15H,3,6-11H2,1-2H3,(H,23,24,25,26) |
| InChIKey | NBHZPZINTQWPDP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|