C23H29N4O3P — CID 170088513
7-methoxy-N-(3-methyl-4-phosphanylphenyl)-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine (PubChem CID 170088513) has the molecular formula C23H29N4O3P and a molecular weight of 440.48 g/mol. Its IUPAC name is 7-methoxy-N-(3-methyl-4-phosphanylphenyl)-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
| Compound Name | 7-methoxy-N-(3-methyl-4-phosphanylphenyl)-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 170088513 |
| Molecular Formula | C23H29N4O3P |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 7-methoxy-N-(3-methyl-4-phosphanylphenyl)-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(P)c(C)c3)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C23H29N4O3P/c1-16-12-17(4-5-22(16)31)26-23-18-13-21(20(28-2)14-19(18)24-15-25-23)30-9-3-6-27-7-10-29-11-8-27/h4-5,12-15H,3,6-11,31H2,1-2H3,(H,24,25,26) |
| InChIKey | LYNXBHFRDNFNCX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|