C22H26ClN4O2P — CID 129263058
N-(3-chloro-4-phosphanylphenyl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine (PubChem CID 129263058) has the molecular formula C22H26ClN4O2P and a molecular weight of 444.90 g/mol. Its IUPAC name is N-(3-chloro-4-phosphanylphenyl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-phosphanylphenyl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 129263058 |
| Molecular Formula | C22H26ClN4O2P |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-(3-chloro-4-phosphanylphenyl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(P)c(Cl)c3)ncnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C22H26ClN4O2P/c1-28-19-12-16-18(13-20(19)29-10-4-9-27-7-2-3-8-27)24-14-25-22(16)26-15-5-6-21(30)17(23)11-15/h5-6,11-14H,2-4,7-10,30H2,1H3,(H,24,25,26) |
| InChIKey | HLKJGSZZVGWZJY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|