C30H34ClN7O3 — CID 134152440
1-[2-chloro-4-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]phenyl]-3-phenylurea (PubChem CID 134152440) has the molecular formula C30H34ClN7O3 and a molecular weight of 576.10 g/mol. Its IUPAC name is 1-[2-chloro-4-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]phenyl]-3-phenylurea.
| Compound Name | 1-[2-chloro-4-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 134152440 |
| Molecular Formula | C30H34ClN7O3 |
| Molecular Weight | 576.10 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 1-[2-chloro-4-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]phenyl]-3-phenylurea |
| SMILES | COc1cc2c(Nc3ccc(NC(=O)Nc4ccccc4)c(Cl)c3)ncnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C30H34ClN7O3/c1-37-12-14-38(15-13-37)11-6-16-41-28-19-26-23(18-27(28)40-2)29(33-20-32-26)34-22-9-10-25(24(31)17-22)36-30(39)35-21-7-4-3-5-8-21/h3-5,7-10,17-20H,6,11-16H2,1-2H3,(H,32,33,34)(H2,35,36,39) |
| InChIKey | HQHBKFFDVBPVBM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.10 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|