C32H36N8O3S — CID 51347470
1-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]-3-(3-methylphenyl)urea (PubChem CID 51347470) has the molecular formula C32H36N8O3S and a molecular weight of 612.76 g/mol. Its IUPAC name is 1-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 51347470 |
| Molecular Formula | C32H36N8O3S |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 1-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]-3-(3-methylphenyl)urea |
| SMILES | COc1cc2c(Nc3ccc4nc(NC(=O)Nc5cccc(C)c5)sc4c3)ncnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C32H36N8O3S/c1-21-6-4-7-22(16-21)36-31(41)38-32-37-25-9-8-23(17-29(25)44-32)35-30-24-18-27(42-3)28(19-26(24)33-20-34-30)43-15-5-10-40-13-11-39(2)12-14-40/h4,6-9,16-20H,5,10-15H2,1-3H3,(H,33,34,35)(H2,36,37,38,41) |
| InChIKey | GMLBNCULIGHRKU-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|