C31H32F2N8O3S — CID 51347321
1-(2,4-difluorophenyl)-3-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]urea (PubChem CID 51347321) has the molecular formula C31H32F2N8O3S and a molecular weight of 634.71 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 51347321 |
| Molecular Formula | C31H32F2N8O3S |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]urea |
| SMILES | COc1cc2c(Nc3ccc4nc(NC(=O)Nc5ccc(F)cc5F)sc4c3)ncnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C31H32F2N8O3S/c1-40-9-11-41(12-10-40)8-3-13-44-27-17-25-21(16-26(27)43-2)29(35-18-34-25)36-20-5-7-24-28(15-20)45-31(38-24)39-30(42)37-23-6-4-19(32)14-22(23)33/h4-7,14-18H,3,8-13H2,1-2H3,(H,34,35,36)(H2,37,38,39,42) |
| InChIKey | UPZFWMZDUDCYTH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|