C29H32N8O4S — CID 67057023
1-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzoxazol-2-yl]-3-thiophen-2-ylurea (PubChem CID 67057023) has the molecular formula C29H32N8O4S and a molecular weight of 588.69 g/mol. Its IUPAC name is 1-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzoxazol-2-yl]-3-thiophen-2-ylurea.
| Compound Name | 1-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzoxazol-2-yl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 67057023 |
| Molecular Formula | C29H32N8O4S |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 1-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzoxazol-2-yl]-3-thiophen-2-ylurea |
| SMILES | COc1cc2c(Nc3ccc4nc(NC(=O)Nc5cccs5)oc4c3)ncnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C29H32N8O4S/c1-36-9-11-37(12-10-36)8-4-13-40-25-17-22-20(16-24(25)39-2)27(31-18-30-22)32-19-6-7-21-23(15-19)41-29(33-21)35-28(38)34-26-5-3-14-42-26/h3,5-7,14-18H,4,8-13H2,1-2H3,(H,30,31,32)(H2,33,34,35,38) |
| InChIKey | APLYBYWPKRJDCZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|