C33H36N4O5 — CID 21035063
7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxy-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile (PubChem CID 21035063) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is 7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxy-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile.
| Compound Name | 7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxy-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 21035063 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 7-[3-[4-(hydroxymethyl)piperidin-1-yl]propoxy]-6-methoxy-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile |
| SMILES | COc1cc2c(Nc3ccc(Oc4ccccc4OC)cc3)c(C#N)cnc2cc1OCCCN1CCC(CO)CC1 |
| InChI | InChI=1S/C33H36N4O5/c1-39-29-6-3-4-7-30(29)42-26-10-8-25(9-11-26)36-33-24(20-34)21-35-28-19-32(31(40-2)18-27(28)33)41-17-5-14-37-15-12-23(22-38)13-16-37/h3-4,6-11,18-19,21,23,38H,5,12-17,22H2,1-2H3,(H,35,36) |
| InChIKey | WHKJWIXWBAWJLQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|