C32H36N4O6S — CID 69255583
7-[3-[(1,1-dihydroxythiolan-3-yl)-methylamino]propoxy]-6-methoxy-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile (PubChem CID 69255583) has the molecular formula C32H36N4O6S and a molecular weight of 604.73 g/mol. Its IUPAC name is 7-[3-[(1,1-dihydroxythiolan-3-yl)-methylamino]propoxy]-6-methoxy-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile.
| Compound Name | 7-[3-[(1,1-dihydroxythiolan-3-yl)-methylamino]propoxy]-6-methoxy-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69255583 |
| Molecular Formula | C32H36N4O6S |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 7-[3-[(1,1-dihydroxythiolan-3-yl)-methylamino]propoxy]-6-methoxy-4-[4-(2-methoxyphenoxy)anilino]quinoline-3-carbonitrile |
| SMILES | COc1cc2c(Nc3ccc(Oc4ccccc4OC)cc3)c(C#N)cnc2cc1OCCCN(C)C1CCS(O)(O)C1 |
| InChI | InChI=1S/C32H36N4O6S/c1-36(24-13-16-43(37,38)21-24)14-6-15-41-31-18-27-26(17-30(31)40-3)32(22(19-33)20-34-27)35-23-9-11-25(12-10-23)42-29-8-5-4-7-28(29)39-2/h4-5,7-12,17-18,20,24,37-38H,6,13-16,21H2,1-3H3,(H,34,35) |
| InChIKey | QMVTVRSUVCHMFA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|