C20H20ClN3O3 — CID 146055598
4-(4-ethoxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile;hydrochloride (PubChem CID 146055598) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 4-(4-ethoxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile;hydrochloride.
| Compound Name | 4-(4-ethoxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 146055598 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-(4-ethoxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile;hydrochloride |
| SMILES | CCOc1ccc(Nc2c(C#N)cnc3cc(OC)c(OC)cc23)cc1.Cl |
| InChI | InChI=1S/C20H19N3O3.ClH/c1-4-26-15-7-5-14(6-8-15)23-20-13(11-21)12-22-17-10-19(25-3)18(24-2)9-16(17)20;/h5-10,12H,4H2,1-3H3,(H,22,23);1H |
| InChIKey | UIKMESXKDBANTO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |