C18H16ClN3O — CID 146055711
4-anilino-6-ethoxyquinoline-3-carbonitrile;hydrochloride (PubChem CID 146055711) has the molecular formula C18H16ClN3O and a molecular weight of 325.80 g/mol. Its IUPAC name is 4-anilino-6-ethoxyquinoline-3-carbonitrile;hydrochloride.
| Compound Name | 4-anilino-6-ethoxyquinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 146055711 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-anilino-6-ethoxyquinoline-3-carbonitrile;hydrochloride |
| SMILES | CCOc1ccc2ncc(C#N)c(Nc3ccccc3)c2c1.Cl |
| InChI | InChI=1S/C18H15N3O.ClH/c1-2-22-15-8-9-17-16(10-15)18(13(11-19)12-20-17)21-14-6-4-3-5-7-14;/h3-10,12H,2H2,1H3,(H,20,21);1H |
| InChIKey | TWXRKPIMVRROFB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |