C18H13ClFN3O — CID 27655777
4-(3-chloro-4-fluoroanilino)-6-ethoxyquinoline-3-carbonitrile (PubChem CID 27655777) has the molecular formula C18H13ClFN3O and a molecular weight of 341.77 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-6-ethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-6-ethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 27655777 |
| Molecular Formula | C18H13ClFN3O |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-6-ethoxyquinoline-3-carbonitrile |
| SMILES | CCOc1ccc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C18H13ClFN3O/c1-2-24-13-4-6-17-14(8-13)18(11(9-21)10-22-17)23-12-3-5-16(20)15(19)7-12/h3-8,10H,2H2,1H3,(H,22,23) |
| InChIKey | WXQDMBWDCPSXOH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |