C17H12ClN3 — CID 50768417
6-chloro-4-(4-methylanilino)quinoline-3-carbonitrile (PubChem CID 50768417) has the molecular formula C17H12ClN3 and a molecular weight of 293.76 g/mol. Its IUPAC name is 6-chloro-4-(4-methylanilino)quinoline-3-carbonitrile.
| Compound Name | 6-chloro-4-(4-methylanilino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 50768417 |
| Molecular Formula | C17H12ClN3 |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 6-chloro-4-(4-methylanilino)quinoline-3-carbonitrile |
| SMILES | Cc1ccc(Nc2c(C#N)cnc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C17H12ClN3/c1-11-2-5-14(6-3-11)21-17-12(9-19)10-20-16-7-4-13(18)8-15(16)17/h2-8,10H,1H3,(H,20,21) |
| InChIKey | NTEZRKKOKCIWHG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |