C18H14Cl2FN3 — CID 45283835
4-(3-chloro-4-fluoroanilino)-6-ethylquinoline-3-carbonitrile;hydrochloride (PubChem CID 45283835) has the molecular formula C18H14Cl2FN3 and a molecular weight of 362.24 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-6-ethylquinoline-3-carbonitrile;hydrochloride.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-6-ethylquinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 45283835 |
| Molecular Formula | C18H14Cl2FN3 |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-6-ethylquinoline-3-carbonitrile;hydrochloride |
| SMILES | CCc1ccc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2c1.Cl |
| InChI | InChI=1S/C18H13ClFN3.ClH/c1-2-11-3-6-17-14(7-11)18(12(9-21)10-22-17)23-13-4-5-16(20)15(19)8-13;/h3-8,10H,2H2,1H3,(H,22,23);1H |
| InChIKey | OKQPMEXSDFXOCR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |