C23H17ClFN5 — CID 69259031
4-(3-chloro-4-fluoroanilino)-7-methyl-6-(pyridin-3-ylmethylamino)quinoline-3-carbonitrile (PubChem CID 69259031) has the molecular formula C23H17ClFN5 and a molecular weight of 417.88 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-7-methyl-6-(pyridin-3-ylmethylamino)quinoline-3-carbonitrile.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-7-methyl-6-(pyridin-3-ylmethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69259031 |
| Molecular Formula | C23H17ClFN5 |
| Molecular Weight | 417.88 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-7-methyl-6-(pyridin-3-ylmethylamino)quinoline-3-carbonitrile |
| SMILES | Cc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1NCc1cccnc1 |
| InChI | InChI=1S/C23H17ClFN5/c1-14-7-22-18(9-21(14)28-12-15-3-2-6-27-11-15)23(16(10-26)13-29-22)30-17-4-5-20(25)19(24)8-17/h2-9,11,13,28H,12H2,1H3,(H,29,30) |
| InChIKey | XTCDMQMWLPKZTM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.88 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |