C22H15ClIN5 — CID 69258739
4-(3-chloroanilino)-8-iodo-6-(pyridin-3-ylmethylamino)quinoline-3-carbonitrile (PubChem CID 69258739) has the molecular formula C22H15ClIN5 and a molecular weight of 511.75 g/mol. Its IUPAC name is 4-(3-chloroanilino)-8-iodo-6-(pyridin-3-ylmethylamino)quinoline-3-carbonitrile.
| Compound Name | 4-(3-chloroanilino)-8-iodo-6-(pyridin-3-ylmethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69258739 |
| Molecular Formula | C22H15ClIN5 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | 4-(3-chloroanilino)-8-iodo-6-(pyridin-3-ylmethylamino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2c(I)cc(NCc3cccnc3)cc2c1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H15ClIN5/c23-16-4-1-5-17(7-16)29-21-15(10-25)13-28-22-19(21)8-18(9-20(22)24)27-12-14-3-2-6-26-11-14/h1-9,11,13,27H,12H2,(H,28,29) |
| InChIKey | QRIJJDVEONGXMV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|