C24H15ClFN5 — CID 69258656
4-(3-chloro-4-fluoroanilino)-6-[(4-cyanophenyl)methylamino]quinoline-3-carbonitrile (PubChem CID 69258656) has the molecular formula C24H15ClFN5 and a molecular weight of 427.87 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-6-[(4-cyanophenyl)methylamino]quinoline-3-carbonitrile.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-6-[(4-cyanophenyl)methylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69258656 |
| Molecular Formula | C24H15ClFN5 |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-6-[(4-cyanophenyl)methylamino]quinoline-3-carbonitrile |
| SMILES | N#Cc1ccc(CNc2ccc3ncc(C#N)c(Nc4ccc(F)c(Cl)c4)c3c2)cc1 |
| InChI | InChI=1S/C24H15ClFN5/c25-21-10-19(5-7-22(21)26)31-24-17(12-28)14-30-23-8-6-18(9-20(23)24)29-13-16-3-1-15(11-27)2-4-16/h1-10,14,29H,13H2,(H,30,31) |
| InChIKey | SVLVGUIJJIZQTH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |