C16H9ClF2N4 — CID 69316825
4-[(3-chloro-4-fluorophenyl)methylamino]-6-fluoro-1,7-naphthyridine-3-carbonitrile (PubChem CID 69316825) has the molecular formula C16H9ClF2N4 and a molecular weight of 330.73 g/mol. Its IUPAC name is 4-[(3-chloro-4-fluorophenyl)methylamino]-6-fluoro-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 4-[(3-chloro-4-fluorophenyl)methylamino]-6-fluoro-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 69316825 |
| Molecular Formula | C16H9ClF2N4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-[(3-chloro-4-fluorophenyl)methylamino]-6-fluoro-1,7-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cnc2cnc(F)cc2c1NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H9ClF2N4/c17-12-3-9(1-2-13(12)18)6-23-16-10(5-20)7-21-14-8-22-15(19)4-11(14)16/h1-4,7-8H,6H2,(H,21,23) |
| InChIKey | MOLUQXWMPHUQMP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|