C21H19Cl2N3O2 — CID 10136640
4-[(3,4-dichlorophenyl)methylamino]-6,7-diethoxyquinoline-3-carbonitrile (PubChem CID 10136640) has the molecular formula C21H19Cl2N3O2 and a molecular weight of 416.31 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylamino]-6,7-diethoxyquinoline-3-carbonitrile.
| Compound Name | 4-[(3,4-dichlorophenyl)methylamino]-6,7-diethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 10136640 |
| Molecular Formula | C21H19Cl2N3O2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylamino]-6,7-diethoxyquinoline-3-carbonitrile |
| SMILES | CCOc1cc2ncc(C#N)c(NCc3ccc(Cl)c(Cl)c3)c2cc1OCC |
| InChI | InChI=1S/C21H19Cl2N3O2/c1-3-27-19-8-15-18(9-20(19)28-4-2)25-12-14(10-24)21(15)26-11-13-5-6-16(22)17(23)7-13/h5-9,12H,3-4,11H2,1-2H3,(H,25,26) |
| InChIKey | KSTABQDMPVWBQA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |