C20H17N3O3 — CID 50768588
4-(1,3-benzodioxol-5-ylmethylamino)-6-ethoxyquinoline-3-carbonitrile (PubChem CID 50768588) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylamino)-6-ethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylamino)-6-ethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 50768588 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylamino)-6-ethoxyquinoline-3-carbonitrile |
| SMILES | CCOc1ccc2ncc(C#N)c(NCc3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C20H17N3O3/c1-2-24-15-4-5-17-16(8-15)20(14(9-21)11-22-17)23-10-13-3-6-18-19(7-13)26-12-25-18/h3-8,11H,2,10,12H2,1H3,(H,22,23) |
| InChIKey | SEXXLLILULWTLZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |