C13H10N4O2 — CID 63658356
5-(1,3-benzodioxol-5-ylmethylamino)pyrazine-2-carbonitrile (PubChem CID 63658356) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylamino)pyrazine-2-carbonitrile.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylamino)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 63658356 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylamino)pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(NCc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C13H10N4O2/c14-4-10-6-17-13(7-15-10)16-5-9-1-2-11-12(3-9)19-8-18-11/h1-3,6-7H,5,8H2,(H,16,17) |
| InChIKey | XAYWPZNUYXFWBP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |