C15H12N4O2 — CID 78980843
N-(1,3-benzodioxol-5-ylmethyl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 78980843) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 78980843 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | c1cnc2nc(NCc3ccc4c(c3)OCO4)ccc2n1 |
| InChI | InChI=1S/C15H12N4O2/c1-3-12-13(21-9-20-12)7-10(1)8-18-14-4-2-11-15(19-14)17-6-5-16-11/h1-7H,8-9H2,(H,17,18,19) |
| InChIKey | AJKGICYRPSYONK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |