C12H11N3O2 — CID 62907156
N-(1,3-benzodioxol-5-ylmethyl)pyrimidin-4-amine (PubChem CID 62907156) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)pyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 62907156 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)pyrimidin-4-amine |
| SMILES | c1cc(NCc2ccc3c(c2)OCO3)ncn1 |
| InChI | InChI=1S/C12H11N3O2/c1-2-10-11(17-8-16-10)5-9(1)6-14-12-3-4-13-7-15-12/h1-5,7H,6,8H2,(H,13,14,15) |
| InChIKey | OWJQKZUBNFAMSP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |