C18H22N4O2 — CID 112856206
6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-cyclohexylpyrimidine-4,6-diamine (PubChem CID 112856206) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-cyclohexylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-cyclohexylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112856206 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-cyclohexylpyrimidine-4,6-diamine |
| SMILES | c1nc(NCc2ccc3c(c2)OCO3)cc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-4-14(5-3-1)22-18-9-17(20-11-21-18)19-10-13-6-7-15-16(8-13)24-12-23-15/h6-9,11,14H,1-5,10,12H2,(H2,19,20,21,22) |
| InChIKey | SMCFOZPOPGWWBU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |