C19H22N4O3 — CID 109113004
6-(1,3-benzodioxol-5-ylmethylamino)-N-cyclohexylpyridazine-3-carboxamide (PubChem CID 109113004) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)-N-cyclohexylpyridazine-3-carboxamide.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)-N-cyclohexylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109113004 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)-N-cyclohexylpyridazine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(NCc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C19H22N4O3/c24-19(21-14-4-2-1-3-5-14)15-7-9-18(23-22-15)20-11-13-6-8-16-17(10-13)26-12-25-16/h6-10,14H,1-5,11-12H2,(H,20,23)(H,21,24) |
| InChIKey | VZVYTKACBWHLFD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |