C13H11N3O4 — CID 62907498
6-(1,3-benzodioxol-5-ylmethylamino)pyridazine-3-carboxylic acid (PubChem CID 62907498) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)pyridazine-3-carboxylic acid.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 62907498 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C13H11N3O4/c17-13(18)9-2-4-12(16-15-9)14-6-8-1-3-10-11(5-8)20-7-19-10/h1-5H,6-7H2,(H,14,16)(H,17,18) |
| InChIKey | BIHDZJCXFYCCHS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |