C13H12N4O3 — CID 79006050
6-(1,3-benzodioxol-5-ylmethylamino)pyridazine-3-carboxamide (PubChem CID 79006050) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)pyridazine-3-carboxamide.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 79006050 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)pyridazine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NCc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C13H12N4O3/c14-13(18)9-2-4-12(17-16-9)15-6-8-1-3-10-11(5-8)20-7-19-10/h1-5H,6-7H2,(H2,14,18)(H,15,17) |
| InChIKey | BBZURPJOCLZVDC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |