C18H22N4O — CID 109112282
N-cyclopentyl-6-[(3-methylphenyl)methylamino]pyridazine-3-carboxamide (PubChem CID 109112282) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-cyclopentyl-6-[(3-methylphenyl)methylamino]pyridazine-3-carboxamide.
| Compound Name | N-cyclopentyl-6-[(3-methylphenyl)methylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109112282 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-cyclopentyl-6-[(3-methylphenyl)methylamino]pyridazine-3-carboxamide |
| SMILES | Cc1cccc(CNc2ccc(C(=O)NC3CCCC3)nn2)c1 |
| InChI | InChI=1S/C18H22N4O/c1-13-5-4-6-14(11-13)12-19-17-10-9-16(21-22-17)18(23)20-15-7-2-3-8-15/h4-6,9-11,15H,2-3,7-8,12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | SADVFYWXUCWYHZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |