C20H21N5O2 — CID 112860429
6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[4-(dimethylamino)phenyl]pyrimidine-4,6-diamine (PubChem CID 112860429) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[4-(dimethylamino)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[4-(dimethylamino)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112860429 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[4-(dimethylamino)phenyl]pyrimidine-4,6-diamine |
| SMILES | CN(C)c1ccc(Nc2cc(NCc3ccc4c(c3)OCO4)ncn2)cc1 |
| InChI | InChI=1S/C20H21N5O2/c1-25(2)16-6-4-15(5-7-16)24-20-10-19(22-12-23-20)21-11-14-3-8-17-18(9-14)27-13-26-17/h3-10,12H,11,13H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | QIQVGQCFSVJVFB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|