C21H23N5O2 — CID 112918854
2-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 112918854) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112918854 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(N(C)C)cc2)nc(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C21H23N5O2/c1-14-10-20(24-16-5-7-17(8-6-16)26(2)3)25-21(23-14)22-12-15-4-9-18-19(11-15)28-13-27-18/h4-11H,12-13H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | AXRSDURVJAMLMS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|