C24H20N4O2 — CID 112937087
2-N-(1,3-benzodioxol-5-ylmethyl)-4-N,6-diphenylpyrimidine-2,4-diamine (PubChem CID 112937087) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N,6-diphenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N,6-diphenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112937087 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N,6-diphenylpyrimidine-2,4-diamine |
| SMILES | c1ccc(Nc2cc(-c3ccccc3)nc(NCc3ccc4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C24H20N4O2/c1-3-7-18(8-4-1)20-14-23(26-19-9-5-2-6-10-19)28-24(27-20)25-15-17-11-12-21-22(13-17)30-16-29-21/h1-14H,15-16H2,(H2,25,26,27,28) |
| InChIKey | HRXGAZAXQSPITO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |