C20H18N4O2 — CID 112933059
2-N-(1,3-benzodioxol-5-yl)-4-N-cyclopropyl-6-phenylpyrimidine-2,4-diamine (PubChem CID 112933059) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-yl)-4-N-cyclopropyl-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-yl)-4-N-cyclopropyl-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933059 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-yl)-4-N-cyclopropyl-6-phenylpyrimidine-2,4-diamine |
| SMILES | c1ccc(-c2cc(NC3CC3)nc(Nc3ccc4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-2-4-13(5-3-1)16-11-19(21-14-6-7-14)24-20(23-16)22-15-8-9-17-18(10-15)26-12-25-17/h1-5,8-11,14H,6-7,12H2,(H2,21,22,23,24) |
| InChIKey | XBGFGMNLFNSJBB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |