C22H25N5O2 — CID 112936235
4-N-(1,3-benzodioxol-5-yl)-2-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine (PubChem CID 112936235) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-2-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-2-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112936235 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-2-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(Nc2ccc3c(c2)OCO3)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H25N5O2/c1-27(2)12-6-11-23-22-25-18(16-7-4-3-5-8-16)14-21(26-22)24-17-9-10-19-20(13-17)29-15-28-19/h3-5,7-10,13-14H,6,11-12,15H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | UCISSEUIPJXQLL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|