C22H27N5O — CID 112936139
4-N-[3-(dimethylamino)propyl]-2-N-(3-methoxyphenyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112936139) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-2-N-(3-methoxyphenyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-2-N-(3-methoxyphenyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112936139 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-2-N-(3-methoxyphenyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | COc1cccc(Nc2nc(NCCCN(C)C)cc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H27N5O/c1-27(2)14-8-13-23-21-16-20(17-9-5-4-6-10-17)25-22(26-21)24-18-11-7-12-19(15-18)28-3/h4-7,9-12,15-16H,8,13-14H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | QTJLPYSVZSAICY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|