C23H29N5 — CID 112936116
4-N-[3-(dimethylamino)propyl]-2-N-(2,5-dimethylphenyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112936116) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-2-N-(2,5-dimethylphenyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-2-N-(2,5-dimethylphenyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112936116 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-2-N-(2,5-dimethylphenyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1ccc(C)c(Nc2nc(NCCCN(C)C)cc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H29N5/c1-17-11-12-18(2)20(15-17)25-23-26-21(19-9-6-5-7-10-19)16-22(27-23)24-13-8-14-28(3)4/h5-7,9-12,15-16H,8,13-14H2,1-4H3,(H2,24,25,26,27) |
| InChIKey | XRIGPIMPXYSJNL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|