C22H26ClN5 — CID 112936136
2-N-(3-chloro-4-methylphenyl)-4-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine (PubChem CID 112936136) has the molecular formula C22H26ClN5 and a molecular weight of 395.94 g/mol. Its IUPAC name is 2-N-(3-chloro-4-methylphenyl)-4-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-chloro-4-methylphenyl)-4-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112936136 |
| Molecular Formula | C22H26ClN5 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-N-(3-chloro-4-methylphenyl)-4-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(NCCCN(C)C)cc(-c3ccccc3)n2)cc1Cl |
| InChI | InChI=1S/C22H26ClN5/c1-16-10-11-18(14-19(16)23)25-22-26-20(17-8-5-4-6-9-17)15-21(27-22)24-12-7-13-28(2)3/h4-6,8-11,14-15H,7,12-13H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | AWZSSMFYHHIPMD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|